About molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine
molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine (PubChem CID 144873811) has the molecular formula C18H31N
and a molecular weight of 261.45 g/mol. Its IUPAC name is molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine |
| PubChem CID | 144873811 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine |
| SMILES | CC(C)C1(c2ccc(C3(N)CC3)cc2)CC1.CCC.[H][H] |
| InChI | InChI=1S/C15H21N.C3H8.H2/c1-11(2)14(7-8-14)12-3-5-13(6-4-12)15(16)9-10-15;1-3-2;/h3-6,11H,7-10,16H2,1-2H3;3H2,1-2H3;1H |
| InChIKey | HVBUBMWEBOFJJI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine?
The IUPAC name of molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine (CID 144873811) is molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine.
What is the SMILES notation for molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine?
The canonical SMILES for molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine is CC(C)C1(c2ccc(C3(N)CC3)cc2)CC1.CCC.[H][H].
What is the InChIKey of molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine?
The InChIKey is HVBUBMWEBOFJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N.C3H8.H2/c1-11(2)14(7-8-14)12-3-5-13(6-4-12)15(16)9-10-15;1-3-2;/h3-6,11H,7-10,16H2,1-2H3;3H2,1-2H3;1H.
What are the key properties of molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine?
molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine has a molecular weight of 261.45 g/mol, XLogP of 4.98, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;propane;1-[4-(1-propan-2-ylcyclopropyl)phenyl]cyclopropan-1-amine is sourced from PubChem (CID 144873811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).