C13H20N2 — CID 82609357
4-(1-aminocyclopropyl)-N,N-diethylaniline (PubChem CID 82609357) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-(1-aminocyclopropyl)-N,N-diethylaniline.
| Compound Name | 4-(1-aminocyclopropyl)-N,N-diethylaniline |
|---|---|
| PubChem CID | 82609357 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4-(1-aminocyclopropyl)-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C2(N)CC2)cc1 |
| InChI | InChI=1S/C13H20N2/c1-3-15(4-2)12-7-5-11(6-8-12)13(14)9-10-13/h5-8H,3-4,9-10,14H2,1-2H3 |
| InChIKey | GUEWAMPVRQJPRM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |