C31H30 — CID 144876245
ethane;(8Z)-2'-methylspiro[7,10-dihydrocycloocta[a]indene-11,10'-7H-benzo[a]azulene] (PubChem CID 144876245) has the molecular formula C31H30 and a molecular weight of 402.58 g/mol. Its IUPAC name is ethane;(8Z)-2'-methylspiro[7,10-dihydrocycloocta[a]indene-11,10'-7H-benzo[a]azulene].
| Compound Name | ethane;(8Z)-2'-methylspiro[7,10-dihydrocycloocta[a]indene-11,10'-7H-benzo[a]azulene] |
|---|---|
| PubChem CID | 144876245 |
| Molecular Formula | C31H30 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | ethane;(8Z)-2'-methylspiro[7,10-dihydrocycloocta[a]indene-11,10'-7H-benzo[a]azulene] |
| SMILES | CC.Cc1ccc2c(c1)C1(C3=C2C=CCC=C3)C2=C(C=CC/C=C\C2)c2ccccc21 |
| InChI | InChI=1S/C29H24.C2H6/c1-20-17-18-24-23-12-6-4-8-15-26(23)29(28(24)19-20)25-14-7-3-2-5-11-21(25)22-13-9-10-16-27(22)29;1-2/h3,5-13,15-19H,2,4,14H2,1H3;1-2H3/b7-3-,11-5?; |
| InChIKey | OSIOQMFSGMLIEE-GBTKXOAMSA-N |
| XLogP | 8.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|