C57H40N2O2 — CID 163766448
1-N-(7'-methyl-9,9'-spirobi[fluorene]-2'-yl)-4-N-spiro[1,2-dihydrofluorene-9,9'-fluorene]-2'-ylbenzene-1,4-diamine oxide (PubChem CID 163766448) has the molecular formula C57H40N2O2 and a molecular weight of 784.96 g/mol. Its IUPAC name is 1-N-(7'-methyl-9,9'-spirobi[fluorene]-2'-yl)-4-N-spiro[1,2-dihydrofluorene-9,9'-fluorene]-2'-ylbenzene-1,4-diamine oxide.
| Compound Name | 1-N-(7'-methyl-9,9'-spirobi[fluorene]-2'-yl)-4-N-spiro[1,2-dihydrofluorene-9,9'-fluorene]-2'-ylbenzene-1,4-diamine oxide |
|---|---|
| PubChem CID | 163766448 |
| Molecular Formula | C57H40N2O2 |
| Molecular Weight | 784.96 g/mol |
| Exact Mass | 784.31 |
| IUPAC Name | 1-N-(7'-methyl-9,9'-spirobi[fluorene]-2'-yl)-4-N-spiro[1,2-dihydrofluorene-9,9'-fluorene]-2'-ylbenzene-1,4-diamine oxide |
| SMILES | Cc1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1cc([NH+]([O-])c3ccc([NH+]([O-])c4ccc5c(c4)C4(C6=C(C=CCC6)c6ccccc64)c4ccccc4-5)cc3)ccc1-2 |
| InChI | InChI=1S/C57H40N2O2/c1-35-22-29-45-47-31-28-39(34-55(47)57(53(45)32-35)51-20-10-4-14-42(51)43-15-5-11-21-52(43)57)59(61)37-25-23-36(24-26-37)58(60)38-27-30-46-44-16-6-9-19-50(44)56(54(46)33-38)48-17-7-2-12-40(48)41-13-3-8-18-49(41)56/h2-7,9-17,19-34,58-59H,8,18H2,1H3 |
| InChIKey | MCRSCBIGUIGONC-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 55.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.96 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|