About 1-cyclopentylimidazole;ethane;methanol
1-cyclopentylimidazole;ethane;methanol (PubChem CID 144877752) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-cyclopentylimidazole;ethane;methanol.
Molecular Properties
| Compound Name | 1-cyclopentylimidazole;ethane;methanol |
| PubChem CID | 144877752 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-cyclopentylimidazole;ethane;methanol |
| SMILES | CC.CO.c1cn(C2CCCC2)cn1 |
| InChI | InChI=1S/C8H12N2.C2H6.CH4O/c1-2-4-8(3-1)10-6-5-9-7-10;2*1-2/h5-8H,1-4H2;1-2H3;2H,1H3 |
| InChIKey | HNHIIGOWXMKIAZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopentylimidazole;ethane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylimidazole;ethane;methanol?
The IUPAC name of 1-cyclopentylimidazole;ethane;methanol (CID 144877752) is 1-cyclopentylimidazole;ethane;methanol.
What is the SMILES notation for 1-cyclopentylimidazole;ethane;methanol?
The canonical SMILES for 1-cyclopentylimidazole;ethane;methanol is CC.CO.c1cn(C2CCCC2)cn1.
What is the InChIKey of 1-cyclopentylimidazole;ethane;methanol?
The InChIKey is HNHIIGOWXMKIAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.C2H6.CH4O/c1-2-4-8(3-1)10-6-5-9-7-10;2*1-2/h5-8H,1-4H2;1-2H3;2H,1H3.
What are the key properties of 1-cyclopentylimidazole;ethane;methanol?
1-cyclopentylimidazole;ethane;methanol has a molecular weight of 198.31 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylimidazole;ethane;methanol is sourced from PubChem (CID 144877752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).