About 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole
1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole (PubChem CID 126638711) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole.
Molecular Properties
| Compound Name | 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole |
| PubChem CID | 126638711 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole |
| SMILES | c1cn(C2C[C@@H]3C[C@@H]3C2)cn1 |
| InChI | InChI=1S/C9H12N2/c1-2-11(6-10-1)9-4-7-3-8(7)5-9/h1-2,6-9H,3-5H2/t7-,8+,9? |
| InChIKey | XPLJQLXJLMQFBT-JVHMLUBASA-N |
| XLogP | 1.85 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole?
The IUPAC name of 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole (CID 126638711) is 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole.
What is the SMILES notation for 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole?
The canonical SMILES for 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole is c1cn(C2C[C@@H]3C[C@@H]3C2)cn1.
What is the InChIKey of 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole?
The InChIKey is XPLJQLXJLMQFBT-JVHMLUBASA-N. The full InChI is InChI=1S/C9H12N2/c1-2-11(6-10-1)9-4-7-3-8(7)5-9/h1-2,6-9H,3-5H2/t7-,8+,9?.
What are the key properties of 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole?
1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole has a molecular weight of 148.21 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]imidazole is sourced from PubChem (CID 126638711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).