C22H32O3 — CID 144878611
[(1R,2S,11S)-10,14-dimethyl-15-oxo-7-tetracyclo[12.3.1.02,11.05,10]octadec-4-enyl] acetate (PubChem CID 144878611) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(1R,2S,11S)-10,14-dimethyl-15-oxo-7-tetracyclo[12.3.1.02,11.05,10]octadec-4-enyl] acetate.
| Compound Name | [(1R,2S,11S)-10,14-dimethyl-15-oxo-7-tetracyclo[12.3.1.02,11.05,10]octadec-4-enyl] acetate |
|---|---|
| PubChem CID | 144878611 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(1R,2S,11S)-10,14-dimethyl-15-oxo-7-tetracyclo[12.3.1.02,11.05,10]octadec-4-enyl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(=CC[C@H]3[C@@H]4CCC(=O)C(C)(CC[C@@H]32)C4)C1 |
| InChI | InChI=1S/C22H32O3/c1-14(23)25-17-8-11-22(3)16(12-17)5-6-18-15-4-7-20(24)21(2,13-15)10-9-19(18)22/h5,15,17-19H,4,6-13H2,1-3H3/t15-,17?,18+,19+,21?,22?/m1/s1 |
| InChIKey | DUVFUAOMJHYQOE-PFLMJYQVSA-N |
| XLogP | 4.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|