C24H34O2 — CID 5151149
(10,13-dimethyl-17-prop-2-enylidene-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 5151149) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (10,13-dimethyl-17-prop-2-enylidene-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (10,13-dimethyl-17-prop-2-enylidene-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 5151149 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (10,13-dimethyl-17-prop-2-enylidene-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | C=CC=C1CCC2C3CC=C4CC(OC(C)=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C24H34O2/c1-5-6-17-8-10-21-20-9-7-18-15-19(26-16(2)25)11-13-24(18,4)22(20)12-14-23(17,21)3/h5-7,19-22H,1,8-15H2,2-4H3 |
| InChIKey | SCZFJLZMTKPHEI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|