C26H37NO5 — CID 71580416
methyl 2-[[(2E)-2-[(3S,8R,9S,10R,13S,14S)-3-acetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]acetyl]amino]acetate (PubChem CID 71580416) has the molecular formula C26H37NO5 and a molecular weight of 443.58 g/mol. Its IUPAC name is methyl 2-[[(2E)-2-[(3S,8R,9S,10R,13S,14S)-3-acetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]acetyl]amino]acetate.
| Compound Name | methyl 2-[[(2E)-2-[(3S,8R,9S,10R,13S,14S)-3-acetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]acetyl]amino]acetate |
|---|---|
| PubChem CID | 71580416 |
| Molecular Formula | C26H37NO5 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | methyl 2-[[(2E)-2-[(3S,8R,9S,10R,13S,14S)-3-acetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)/C=C1\CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H37NO5/c1-16(28)32-19-9-11-25(2)17(13-19)5-7-20-21-8-6-18(26(21,3)12-10-22(20)25)14-23(29)27-15-24(30)31-4/h5,14,19-22H,6-13,15H2,1-4H3,(H,27,29)/b18-14+/t19-,20-,21-,22-,25-,26+/m0/s1 |
| InChIKey | PRQKQXRRLPMRKV-UFHUOUAZSA-N |
| XLogP | 4.10 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|