C30H26FN5O4 — CID 144880229
N-[14-amino-5-fluoro-12-oxo-15-(4-phenoxyphenyl)-9-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-6-yl]prop-2-enamide;ethane (PubChem CID 144880229) has the molecular formula C30H26FN5O4 and a molecular weight of 539.57 g/mol. Its IUPAC name is N-[14-amino-5-fluoro-12-oxo-15-(4-phenoxyphenyl)-9-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-6-yl]prop-2-enamide;ethane.
| Compound Name | N-[14-amino-5-fluoro-12-oxo-15-(4-phenoxyphenyl)-9-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-6-yl]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 144880229 |
| Molecular Formula | C30H26FN5O4 |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | N-[14-amino-5-fluoro-12-oxo-15-(4-phenoxyphenyl)-9-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-6-yl]prop-2-enamide;ethane |
| SMILES | C=CC(=O)Nc1c(F)ccc2c1COc1[nH]c(=O)c3c(N)n(-c4ccc(Oc5ccccc5)cc4)nc3c1-2.CC |
| InChI | InChI=1S/C28H20FN5O4.C2H6/c1-2-21(35)31-24-19-14-37-28-22(18(19)12-13-20(24)29)25-23(27(36)32-28)26(30)34(33-25)15-8-10-17(11-9-15)38-16-6-4-3-5-7-16;1-2/h2-13H,1,14,30H2,(H,31,35)(H,32,36);1-2H3 |
| InChIKey | KPLTWNZSCDMXSH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|