C22H27N3O2 — CID 144881175
ethane;methane;5-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 144881175) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is ethane;methane;5-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | ethane;methane;5-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144881175 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | ethane;methane;5-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | C.CC.NC(=O)c1cncc(Cc2ccc(Cn3ccccc3=O)cc2)c1 |
| InChI | InChI=1S/C19H17N3O2.C2H6.CH4/c20-19(24)17-10-16(11-21-12-17)9-14-4-6-15(7-5-14)13-22-8-2-1-3-18(22)23;1-2;/h1-8,10-12H,9,13H2,(H2,20,24);1-2H3;1H4 |
| InChIKey | YFSGQEKWESQEHP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |