C22H29N5O2 — CID 144881357
5-[[4-(1-acetylpyrrolidin-2-yl)phenyl]methyl]-N-(2-iminoethyl)pyridine-3-carboxamide;methanamine (PubChem CID 144881357) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 5-[[4-(1-acetylpyrrolidin-2-yl)phenyl]methyl]-N-(2-iminoethyl)pyridine-3-carboxamide;methanamine.
| Compound Name | 5-[[4-(1-acetylpyrrolidin-2-yl)phenyl]methyl]-N-(2-iminoethyl)pyridine-3-carboxamide;methanamine |
|---|---|
| PubChem CID | 144881357 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 5-[[4-(1-acetylpyrrolidin-2-yl)phenyl]methyl]-N-(2-iminoethyl)pyridine-3-carboxamide;methanamine |
| SMILES | CN.[H]/N=C/CNC(=O)c1cncc(Cc2ccc(C3CCCN3C(C)=O)cc2)c1 |
| InChI | InChI=1S/C21H24N4O2.CH5N/c1-15(26)25-10-2-3-20(25)18-6-4-16(5-7-18)11-17-12-19(14-23-13-17)21(27)24-9-8-22;1-2/h4-8,12-14,20,22H,2-3,9-11H2,1H3,(H,24,27);2H2,1H3/b22-8+; |
| InChIKey | LEYWYZAKBSNJEH-FKBZEAPWSA-N |
| XLogP | 2.31 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|