C27H22N2O4 — CID 144882573
naphthalen-1-yl-[3-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 144882573) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is naphthalen-1-yl-[3-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | naphthalen-1-yl-[3-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 144882573 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | naphthalen-1-yl-[3-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | O=C(c1cccc2ccccc12)N1Cc2ccccc2CC1COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H22N2O4/c30-27(26-11-5-9-19-6-3-4-10-25(19)26)28-17-21-8-2-1-7-20(21)16-23(28)18-33-24-14-12-22(13-15-24)29(31)32/h1-15,23H,16-18H2 |
| InChIKey | NKGODFHGQPXHMX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|