C17H16N2O4 — CID 141371440
[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(3-nitrophenyl)methanone (PubChem CID 141371440) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is [3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(3-nitrophenyl)methanone.
| Compound Name | [3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 141371440 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1Cc2ccccc2CC1CO |
| InChI | InChI=1S/C17H16N2O4/c20-11-16-8-12-4-1-2-5-14(12)10-18(16)17(21)13-6-3-7-15(9-13)19(22)23/h1-7,9,16,20H,8,10-11H2 |
| InChIKey | YOKDGLZNQBAANA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|