C26H22N2O7 — CID 126004989
2-O-benzyl 3-O-[2-(3-nitrophenyl)-2-oxoethyl] (3S)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 126004989) has the molecular formula C26H22N2O7 and a molecular weight of 474.47 g/mol. Its IUPAC name is 2-O-benzyl 3-O-[2-(3-nitrophenyl)-2-oxoethyl] (3S)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-[2-(3-nitrophenyl)-2-oxoethyl] (3S)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 126004989 |
| Molecular Formula | C26H22N2O7 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-O-benzyl 3-O-[2-(3-nitrophenyl)-2-oxoethyl] (3S)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | O=C(COC(=O)[C@@H]1Cc2ccccc2CN1C(=O)OCc1ccccc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H22N2O7/c29-24(20-11-6-12-22(13-20)28(32)33)17-34-25(30)23-14-19-9-4-5-10-21(19)15-27(23)26(31)35-16-18-7-2-1-3-8-18/h1-13,23H,14-17H2/t23-/m0/s1 |
| InChIKey | LQQIJTURYJYBIC-QHCPKHFHSA-N |
| XLogP | 4.08 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|