C25H24N4O4 — CID 66900643
benzyl 3-[amino-(3-carbamoylphenyl)carbamoyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 66900643) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is benzyl 3-[amino-(3-carbamoylphenyl)carbamoyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl 3-[amino-(3-carbamoylphenyl)carbamoyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 66900643 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | benzyl 3-[amino-(3-carbamoylphenyl)carbamoyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | NC(=O)c1cccc(N(N)C(=O)C2Cc3ccccc3CN2C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H24N4O4/c26-23(30)19-11-6-12-21(13-19)29(27)24(31)22-14-18-9-4-5-10-20(18)15-28(22)25(32)33-16-17-7-2-1-3-8-17/h1-13,22H,14-16,27H2,(H2,26,30) |
| InChIKey | MTTQBZBXIURSIU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|