C42H32N2O2 — CID 144884145
(2Z,4E)-5-[3-[(3Z,5Z)-3-dibenzofuran-4-yl-7-methylidene-2H-1-benzoxonin-11-yl]-5-pyridin-2-ylphenyl]hexa-2,4-dien-1-imine (PubChem CID 144884145) has the molecular formula C42H32N2O2 and a molecular weight of 596.73 g/mol. Its IUPAC name is (2Z,4E)-5-[3-[(3Z,5Z)-3-dibenzofuran-4-yl-7-methylidene-2H-1-benzoxonin-11-yl]-5-pyridin-2-ylphenyl]hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-5-[3-[(3Z,5Z)-3-dibenzofuran-4-yl-7-methylidene-2H-1-benzoxonin-11-yl]-5-pyridin-2-ylphenyl]hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 144884145 |
| Molecular Formula | C42H32N2O2 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | (2Z,4E)-5-[3-[(3Z,5Z)-3-dibenzofuran-4-yl-7-methylidene-2H-1-benzoxonin-11-yl]-5-pyridin-2-ylphenyl]hexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C\C=C(/C)c1cc(-c2ccccn2)cc(-c2cccc3c2OC/C(c2cccc4c2oc2ccccc24)=C\C=C/C3=C)c1 |
| InChI | InChI=1S/C42H32N2O2/c1-28(12-5-7-22-43)31-24-32(26-33(25-31)39-20-6-8-23-44-39)36-18-10-16-34-29(2)13-9-14-30(27-45-41(34)36)35-17-11-19-38-37-15-3-4-21-40(37)46-42(35)38/h3-26,43H,2,27H2,1H3/b7-5-,13-9-,28-12+,30-14+,43-22+ |
| InChIKey | YFOUFBXUUDJTFN-DXDNWMNMSA-N |
| XLogP | 10.97 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|