C18H23NO3 — CID 144885572
4-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethylamino]cyclohexane-1-carbaldehyde (PubChem CID 144885572) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethylamino]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethylamino]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 144885572 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 4-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethylamino]cyclohexane-1-carbaldehyde |
| SMILES | Cc1c(CCNC2CCC(C=O)CC2)ccc2c1COC2=O |
| InChI | InChI=1S/C18H23NO3/c1-12-14(4-7-16-17(12)11-22-18(16)21)8-9-19-15-5-2-13(10-20)3-6-15/h4,7,10,13,15,19H,2-3,5-6,8-9,11H2,1H3 |
| InChIKey | CJOAEEPBYAIQEA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|