C16H20ClNO2 — CID 86730529
4-methyl-5-[(E)-2-piperidin-1-ium-4-ylethenyl]-3H-2-benzofuran-1-one chloride (PubChem CID 86730529) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is 4-methyl-5-[(E)-2-piperidin-1-ium-4-ylethenyl]-3H-2-benzofuran-1-one chloride.
| Compound Name | 4-methyl-5-[(E)-2-piperidin-1-ium-4-ylethenyl]-3H-2-benzofuran-1-one chloride |
|---|---|
| PubChem CID | 86730529 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 4-methyl-5-[(E)-2-piperidin-1-ium-4-ylethenyl]-3H-2-benzofuran-1-one chloride |
| SMILES | Cc1c(/C=C/C2CC[NH2+]CC2)ccc2c1COC2=O.[Cl-] |
| InChI | InChI=1S/C16H19NO2.ClH/c1-11-13(3-2-12-6-8-17-9-7-12)4-5-14-15(11)10-19-16(14)18;/h2-5,12,17H,6-10H2,1H3;1H/b3-2+; |
| InChIKey | QWFLUFAGYAXAGC-SQQVDAMQSA-N |
| XLogP | -1.34 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |