C32H34N4O5S3 — CID 144885837
4-[2-[2-[[2-(cyclopropylamino)-2-oxoethyl]amino]-1-(2-methoxyethylsulfanylsulfinyl)-2-oxoethyl]-1,3-benzothiazol-6-yl]-N-(2-phenylethyl)benzamide (PubChem CID 144885837) has the molecular formula C32H34N4O5S3 and a molecular weight of 650.85 g/mol. Its IUPAC name is 4-[2-[2-[[2-(cyclopropylamino)-2-oxoethyl]amino]-1-(2-methoxyethylsulfanylsulfinyl)-2-oxoethyl]-1,3-benzothiazol-6-yl]-N-(2-phenylethyl)benzamide.
| Compound Name | 4-[2-[2-[[2-(cyclopropylamino)-2-oxoethyl]amino]-1-(2-methoxyethylsulfanylsulfinyl)-2-oxoethyl]-1,3-benzothiazol-6-yl]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 144885837 |
| Molecular Formula | C32H34N4O5S3 |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.17 |
| IUPAC Name | 4-[2-[2-[[2-(cyclopropylamino)-2-oxoethyl]amino]-1-(2-methoxyethylsulfanylsulfinyl)-2-oxoethyl]-1,3-benzothiazol-6-yl]-N-(2-phenylethyl)benzamide |
| SMILES | COCCSS(=O)C(C(=O)NCC(=O)NC1CC1)c1nc2ccc(-c3ccc(C(=O)NCCc4ccccc4)cc3)cc2s1 |
| InChI | InChI=1S/C32H34N4O5S3/c1-41-17-18-42-44(40)29(31(39)34-20-28(37)35-25-12-13-25)32-36-26-14-11-24(19-27(26)43-32)22-7-9-23(10-8-22)30(38)33-16-15-21-5-3-2-4-6-21/h2-11,14,19,25,29H,12-13,15-18,20H2,1H3,(H,33,38)(H,34,39)(H,35,37) |
| InChIKey | ROISTBCLNONKFR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|