C20H22N2O6 — CID 144888078
methyl 2-[2-[(2-amino-2-oxoethyl)-[(3-methoxyphenyl)methyl]carbamoyl]phenoxy]acetate (PubChem CID 144888078) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is methyl 2-[2-[(2-amino-2-oxoethyl)-[(3-methoxyphenyl)methyl]carbamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[(2-amino-2-oxoethyl)-[(3-methoxyphenyl)methyl]carbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 144888078 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | methyl 2-[2-[(2-amino-2-oxoethyl)-[(3-methoxyphenyl)methyl]carbamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1C(=O)N(CC(N)=O)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C20H22N2O6/c1-26-15-7-5-6-14(10-15)11-22(12-18(21)23)20(25)16-8-3-4-9-17(16)28-13-19(24)27-2/h3-10H,11-13H2,1-2H3,(H2,21,23) |
| InChIKey | NBDCDQBKDNYYLH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |