C21H22N2O2S — CID 144888104
N-(2-amino-2-oxoethyl)-N-(1-phenylethyl)thiophene-2-carboxamide;benzene (PubChem CID 144888104) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-(1-phenylethyl)thiophene-2-carboxamide;benzene.
| Compound Name | N-(2-amino-2-oxoethyl)-N-(1-phenylethyl)thiophene-2-carboxamide;benzene |
|---|---|
| PubChem CID | 144888104 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-(1-phenylethyl)thiophene-2-carboxamide;benzene |
| SMILES | CC(c1ccccc1)N(CC(N)=O)C(=O)c1cccs1.c1ccccc1 |
| InChI | InChI=1S/C15H16N2O2S.C6H6/c1-11(12-6-3-2-4-7-12)17(10-14(16)18)15(19)13-8-5-9-20-13;1-2-4-6-5-3-1/h2-9,11H,10H2,1H3,(H2,16,18);1-6H |
| InChIKey | GBFJHCDEEDQLJK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |