C12H15N3O5S — CID 107821254
(2R)-4-amino-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]-4-oxobutanoic acid (PubChem CID 107821254) has the molecular formula C12H15N3O5S and a molecular weight of 313.33 g/mol. Its IUPAC name is (2R)-4-amino-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107821254 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (2R)-4-amino-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]-4-oxobutanoic acid |
| SMILES | CN(CC(=O)N[C@H](CC(N)=O)C(=O)O)C(=O)c1cccs1 |
| InChI | InChI=1S/C12H15N3O5S/c1-15(11(18)8-3-2-4-21-8)6-10(17)14-7(12(19)20)5-9(13)16/h2-4,7H,5-6H2,1H3,(H2,13,16)(H,14,17)(H,19,20)/t7-/m1/s1 |
| InChIKey | MRLDJKLDRASGJA-SSDOTTSWSA-N |
| XLogP | -0.74 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |