C13H18N2O5S — CID 62478757
4-methoxy-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]butanoic acid (PubChem CID 62478757) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is 4-methoxy-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]butanoic acid.
| Compound Name | 4-methoxy-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 62478757 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-methoxy-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]butanoic acid |
| SMILES | COCCC(NC(=O)CN(C)C(=O)c1cccs1)C(=O)O |
| InChI | InChI=1S/C13H18N2O5S/c1-15(12(17)10-4-3-7-21-10)8-11(16)14-9(13(18)19)5-6-20-2/h3-4,7,9H,5-6,8H2,1-2H3,(H,14,16)(H,18,19) |
| InChIKey | XKNXVNAMROJNLL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |