C14H20N2O4S — CID 107144518
(2S)-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]hexanoic acid (PubChem CID 107144518) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is (2S)-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 107144518 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2S)-2-[[2-[methyl(thiophene-2-carbonyl)amino]acetyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CN(C)C(=O)c1cccs1)C(=O)O |
| InChI | InChI=1S/C14H20N2O4S/c1-3-4-6-10(14(19)20)15-12(17)9-16(2)13(18)11-7-5-8-21-11/h5,7-8,10H,3-4,6,9H2,1-2H3,(H,15,17)(H,19,20)/t10-/m0/s1 |
| InChIKey | GOMCGVLCKLCMOP-JTQLQIEISA-N |
| XLogP | 1.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |