C24H19NO6S — CID 144890171
(6R,7S)-8-oxo-3-[(2-oxochromen-7-yl)oxymethyl]-7-phenylmethoxy-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbaldehyde (PubChem CID 144890171) has the molecular formula C24H19NO6S and a molecular weight of 449.48 g/mol. Its IUPAC name is (6R,7S)-8-oxo-3-[(2-oxochromen-7-yl)oxymethyl]-7-phenylmethoxy-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbaldehyde.
| Compound Name | (6R,7S)-8-oxo-3-[(2-oxochromen-7-yl)oxymethyl]-7-phenylmethoxy-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 144890171 |
| Molecular Formula | C24H19NO6S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | (6R,7S)-8-oxo-3-[(2-oxochromen-7-yl)oxymethyl]-7-phenylmethoxy-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbaldehyde |
| SMILES | O=CC1=C(COc2ccc3ccc(=O)oc3c2)CS[C@@H]2[C@@H](OCc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C24H19NO6S/c26-11-19-17(13-29-18-8-6-16-7-9-21(27)31-20(16)10-18)14-32-24-22(23(28)25(19)24)30-12-15-4-2-1-3-5-15/h1-11,22,24H,12-14H2/t22-,24+/m0/s1 |
| InChIKey | MPKVILCAXFSGLN-LADGPHEKSA-N |
| XLogP | 3.13 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|