C24H35F3N4 — CID 144891518
(5Z,7Z)-N-[(Z)-2-[5-(cyclopropylmethyl)-4-methyl-1,2,4-triazol-3-yl]-1,1,1-trifluoropent-2-en-3-yl]-N,3-dimethyl-4-methylidenenona-5,7-dien-1-amine (PubChem CID 144891518) has the molecular formula C24H35F3N4 and a molecular weight of 436.57 g/mol. Its IUPAC name is (5Z,7Z)-N-[(Z)-2-[5-(cyclopropylmethyl)-4-methyl-1,2,4-triazol-3-yl]-1,1,1-trifluoropent-2-en-3-yl]-N,3-dimethyl-4-methylidenenona-5,7-dien-1-amine.
| Compound Name | (5Z,7Z)-N-[(Z)-2-[5-(cyclopropylmethyl)-4-methyl-1,2,4-triazol-3-yl]-1,1,1-trifluoropent-2-en-3-yl]-N,3-dimethyl-4-methylidenenona-5,7-dien-1-amine |
|---|---|
| PubChem CID | 144891518 |
| Molecular Formula | C24H35F3N4 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (5Z,7Z)-N-[(Z)-2-[5-(cyclopropylmethyl)-4-methyl-1,2,4-triazol-3-yl]-1,1,1-trifluoropent-2-en-3-yl]-N,3-dimethyl-4-methylidenenona-5,7-dien-1-amine |
| SMILES | C=C(/C=C\C=C/C)C(C)CCN(C)/C(CC)=C(/c1nnc(CC2CC2)n1C)C(F)(F)F |
| InChI | InChI=1S/C24H35F3N4/c1-7-9-10-11-17(3)18(4)14-15-30(5)20(8-2)22(24(25,26)27)23-29-28-21(31(23)6)16-19-12-13-19/h7,9-11,18-19H,3,8,12-16H2,1-2,4-6H3/b9-7-,11-10-,22-20- |
| InChIKey | IZZJCEZGJNWQLK-OACPQOEASA-N |
| XLogP | 6.10 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|