C28H39N3 — CID 174066094
4-[(2Z,4E,6Z)-cyclodeca-2,4,6-trien-1-yl]-3-[(Z)-4-[(1S)-2-methylcyclopropyl]but-3-enyl]-5-[(3Z,5Z)-octa-3,5-dienyl]-1,2,4-triazole (PubChem CID 174066094) has the molecular formula C28H39N3 and a molecular weight of 417.64 g/mol. Its IUPAC name is 4-[(2Z,4E,6Z)-cyclodeca-2,4,6-trien-1-yl]-3-[(Z)-4-[(1S)-2-methylcyclopropyl]but-3-enyl]-5-[(3Z,5Z)-octa-3,5-dienyl]-1,2,4-triazole.
| Compound Name | 4-[(2Z,4E,6Z)-cyclodeca-2,4,6-trien-1-yl]-3-[(Z)-4-[(1S)-2-methylcyclopropyl]but-3-enyl]-5-[(3Z,5Z)-octa-3,5-dienyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 174066094 |
| Molecular Formula | C28H39N3 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | 4-[(2Z,4E,6Z)-cyclodeca-2,4,6-trien-1-yl]-3-[(Z)-4-[(1S)-2-methylcyclopropyl]but-3-enyl]-5-[(3Z,5Z)-octa-3,5-dienyl]-1,2,4-triazole |
| SMILES | CC/C=C\C=C/CCc1nnc(CC/C=C\[C@H]2CC2C)n1C1/C=C\C=C\C=C/CCC1 |
| InChI | InChI=1S/C28H39N3/c1-3-4-5-6-12-15-21-27-29-30-28(22-17-16-18-25-23-24(25)2)31(27)26-19-13-10-8-7-9-11-14-20-26/h4-10,12-13,16,18-19,24-26H,3,11,14-15,17,20-23H2,1-2H3/b5-4-,9-7-,10-8+,12-6-,18-16-,19-13-/t24?,25-,26?/m0/s1 |
| InChIKey | OXZFAUBKTOIJKT-WIUOGEAZSA-N |
| XLogP | 7.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|