C22H24N4O4 — CID 144891690
(2S)-N-(cyanomethyl)-1,4-oxazepane-2-carboxamide;5-(4-methylphenyl)-3H-1,3-benzoxazol-2-one (PubChem CID 144891690) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-1,4-oxazepane-2-carboxamide;5-(4-methylphenyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | (2S)-N-(cyanomethyl)-1,4-oxazepane-2-carboxamide;5-(4-methylphenyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 144891690 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (2S)-N-(cyanomethyl)-1,4-oxazepane-2-carboxamide;5-(4-methylphenyl)-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1ccc(-c2ccc3oc(=O)[nH]c3c2)cc1.N#CCNC(=O)[C@@H]1CNCCCO1 |
| InChI | InChI=1S/C14H11NO2.C8H13N3O2/c1-9-2-4-10(5-3-9)11-6-7-13-12(8-11)15-14(16)17-13;9-2-4-11-8(12)7-6-10-3-1-5-13-7/h2-8H,1H3,(H,15,16);7,10H,1,3-6H2,(H,11,12)/t;7-/m.0/s1 |
| InChIKey | JTSGBRNEAXRYNB-ZLTKDMPESA-N |
| XLogP | 2.10 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|