C28H38N4O6S — CID 177200695
(2S)-N-(cyanomethyl)-1,4-oxazepane-2-carboxamide;3-[2-(2-hydroxyethoxy)ethyl]-5-(4-methylphenyl)-1,3-benzoxazol-2-one;methylsulfanylmethane (PubChem CID 177200695) has the molecular formula C28H38N4O6S and a molecular weight of 558.70 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-1,4-oxazepane-2-carboxamide;3-[2-(2-hydroxyethoxy)ethyl]-5-(4-methylphenyl)-1,3-benzoxazol-2-one;methylsulfanylmethane.
| Compound Name | (2S)-N-(cyanomethyl)-1,4-oxazepane-2-carboxamide;3-[2-(2-hydroxyethoxy)ethyl]-5-(4-methylphenyl)-1,3-benzoxazol-2-one;methylsulfanylmethane |
|---|---|
| PubChem CID | 177200695 |
| Molecular Formula | C28H38N4O6S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | (2S)-N-(cyanomethyl)-1,4-oxazepane-2-carboxamide;3-[2-(2-hydroxyethoxy)ethyl]-5-(4-methylphenyl)-1,3-benzoxazol-2-one;methylsulfanylmethane |
| SMILES | CSC.Cc1ccc(-c2ccc3oc(=O)n(CCOCCO)c3c2)cc1.N#CCNC(=O)[C@@H]1CNCCCO1 |
| InChI | InChI=1S/C18H19NO4.C8H13N3O2.C2H6S/c1-13-2-4-14(5-3-13)15-6-7-17-16(12-15)19(18(21)23-17)8-10-22-11-9-20;9-2-4-11-8(12)7-6-10-3-1-5-13-7;1-3-2/h2-7,12,20H,8-11H2,1H3;7,10H,1,3-6H2,(H,11,12);1-2H3/t;7-;/m.0./s1 |
| InChIKey | DZRJVMPDGPATRP-IXSARBFQSA-N |
| XLogP | 2.56 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|