C15H26N2 — CID 144892276
N-(2,2-dimethylpropyl)-6-(2-methylbutyl)pyridin-2-amine (PubChem CID 144892276) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-6-(2-methylbutyl)pyridin-2-amine.
| Compound Name | N-(2,2-dimethylpropyl)-6-(2-methylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 144892276 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N-(2,2-dimethylpropyl)-6-(2-methylbutyl)pyridin-2-amine |
| SMILES | CCC(C)Cc1cccc(NCC(C)(C)C)n1 |
| InChI | InChI=1S/C15H26N2/c1-6-12(2)10-13-8-7-9-14(17-13)16-11-15(3,4)5/h7-9,12H,6,10-11H2,1-5H3,(H,16,17) |
| InChIKey | JDGHJIBHRNUSMT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |