C10H20N2 — CID 144892580
1-butyl-3-methyl-2-methylidene-1,3-diazinane (PubChem CID 144892580) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-butyl-3-methyl-2-methylidene-1,3-diazinane.
| Compound Name | 1-butyl-3-methyl-2-methylidene-1,3-diazinane |
|---|---|
| PubChem CID | 144892580 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-butyl-3-methyl-2-methylidene-1,3-diazinane |
| SMILES | C=C1N(C)CCCN1CCCC |
| InChI | InChI=1S/C10H20N2/c1-4-5-8-12-9-6-7-11(3)10(12)2/h2,4-9H2,1,3H3 |
| InChIKey | MNJHSGODVOXKLG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |