C29H46N6O4S — CID 144895013
N-[(1Z,2S)-1-amino-1-hydrazinylidene-3-(4-hydroxyphenyl)propan-2-yl]-2-[4-methyl-3-[methyl-[(3S)-3-methylpentanoyl]amino]-1-propoxypentyl]-1,3-thiazole-4-carboxamide (PubChem CID 144895013) has the molecular formula C29H46N6O4S and a molecular weight of 574.79 g/mol. Its IUPAC name is N-[(1Z,2S)-1-amino-1-hydrazinylidene-3-(4-hydroxyphenyl)propan-2-yl]-2-[4-methyl-3-[methyl-[(3S)-3-methylpentanoyl]amino]-1-propoxypentyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1Z,2S)-1-amino-1-hydrazinylidene-3-(4-hydroxyphenyl)propan-2-yl]-2-[4-methyl-3-[methyl-[(3S)-3-methylpentanoyl]amino]-1-propoxypentyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 144895013 |
| Molecular Formula | C29H46N6O4S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | N-[(1Z,2S)-1-amino-1-hydrazinylidene-3-(4-hydroxyphenyl)propan-2-yl]-2-[4-methyl-3-[methyl-[(3S)-3-methylpentanoyl]amino]-1-propoxypentyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCOC(CC(C(C)C)N(C)C(=O)C[C@@H](C)CC)c1nc(C(=O)N[C@@H](Cc2ccc(O)cc2)/C(N)=N/N)cs1 |
| InChI | InChI=1S/C29H46N6O4S/c1-7-13-39-25(16-24(18(3)4)35(6)26(37)14-19(5)8-2)29-33-23(17-40-29)28(38)32-22(27(30)34-31)15-20-9-11-21(36)12-10-20/h9-12,17-19,22,24-25,36H,7-8,13-16,31H2,1-6H3,(H2,30,34)(H,32,38)/t19-,22-,24?,25?/m0/s1 |
| InChIKey | KDVWXUBCMFJBKL-BYTWGRQSSA-N |
| XLogP | 4.20 |
| TPSA | 156.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|