C38H62N6O7S — CID 155371976
2-(2-aminoethoxy)ethyl N-[[4-[[2-[4-methyl-3-[3-methylpentanoyl(propyl)amino]-1-propoxypentyl]-1,3-thiazole-4-carbonyl]amino]-5-phenylpentanoyl]amino]carbamate (PubChem CID 155371976) has the molecular formula C38H62N6O7S and a molecular weight of 747.02 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl N-[[4-[[2-[4-methyl-3-[3-methylpentanoyl(propyl)amino]-1-propoxypentyl]-1,3-thiazole-4-carbonyl]amino]-5-phenylpentanoyl]amino]carbamate.
| Compound Name | 2-(2-aminoethoxy)ethyl N-[[4-[[2-[4-methyl-3-[3-methylpentanoyl(propyl)amino]-1-propoxypentyl]-1,3-thiazole-4-carbonyl]amino]-5-phenylpentanoyl]amino]carbamate |
|---|---|
| PubChem CID | 155371976 |
| Molecular Formula | C38H62N6O7S |
| Molecular Weight | 747.02 g/mol |
| Exact Mass | 746.44 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl N-[[4-[[2-[4-methyl-3-[3-methylpentanoyl(propyl)amino]-1-propoxypentyl]-1,3-thiazole-4-carbonyl]amino]-5-phenylpentanoyl]amino]carbamate |
| SMILES | CCCOC(CC(C(C)C)N(CCC)C(=O)CC(C)CC)c1nc(C(=O)NC(CCC(=O)NNC(=O)OCCOCCN)Cc2ccccc2)cs1 |
| InChI | InChI=1S/C38H62N6O7S/c1-7-18-44(35(46)23-28(6)9-3)32(27(4)5)25-33(50-19-8-2)37-41-31(26-52-37)36(47)40-30(24-29-13-11-10-12-14-29)15-16-34(45)42-43-38(48)51-22-21-49-20-17-39/h10-14,26-28,30,32-33H,7-9,15-25,39H2,1-6H3,(H,40,47)(H,42,45)(H,43,48) |
| InChIKey | WQNJZRGGMPNJAM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 174.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.02 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|