C11H16N2 — CID 144897685
1,4-dimethyl-7H-cyclohepta[d]imidazole;methane (PubChem CID 144897685) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,4-dimethyl-7H-cyclohepta[d]imidazole;methane.
| Compound Name | 1,4-dimethyl-7H-cyclohepta[d]imidazole;methane |
|---|---|
| PubChem CID | 144897685 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,4-dimethyl-7H-cyclohepta[d]imidazole;methane |
| SMILES | C.CC1=c2ncn(C)c2=CCC=C1 |
| InChI | InChI=1S/C10H12N2.CH4/c1-8-5-3-4-6-9-10(8)11-7-12(9)2;/h3,5-7H,4H2,1-2H3;1H4 |
| InChIKey | YYHVWGSRPNFYDU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |