C10H12N2 — CID 144897686
1,4-dimethyl-7H-cyclohepta[d]imidazole (PubChem CID 144897686) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,4-dimethyl-7H-cyclohepta[d]imidazole.
| Compound Name | 1,4-dimethyl-7H-cyclohepta[d]imidazole |
|---|---|
| PubChem CID | 144897686 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1,4-dimethyl-7H-cyclohepta[d]imidazole |
| SMILES | CC1=c2ncn(C)c2=CCC=C1 |
| InChI | InChI=1S/C10H12N2/c1-8-5-3-4-6-9-10(8)11-7-12(9)2/h3,5-7H,4H2,1-2H3 |
| InChIKey | BBLCLGMFMSGJRR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |