C30H29Cl2F2N7O — CID 144897702
6-[6-[amino-[(E)-2-amino-2-chloroethenyl]amino]-3-chloro-2-fluorophenyl]-3-(4-fluoro-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-14-yl)pyrimidin-4-one (PubChem CID 144897702) has the molecular formula C30H29Cl2F2N7O and a molecular weight of 612.51 g/mol. Its IUPAC name is 6-[6-[amino-[(E)-2-amino-2-chloroethenyl]amino]-3-chloro-2-fluorophenyl]-3-(4-fluoro-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-14-yl)pyrimidin-4-one.
| Compound Name | 6-[6-[amino-[(E)-2-amino-2-chloroethenyl]amino]-3-chloro-2-fluorophenyl]-3-(4-fluoro-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-14-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 144897702 |
| Molecular Formula | C30H29Cl2F2N7O |
| Molecular Weight | 612.51 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | 6-[6-[amino-[(E)-2-amino-2-chloroethenyl]amino]-3-chloro-2-fluorophenyl]-3-(4-fluoro-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-14-yl)pyrimidin-4-one |
| SMILES | CC1CCCC(n2cnc(-c3c(N(N)/C=C(\N)Cl)ccc(Cl)c3F)cc2=O)c2cc(ccn2)-c2cc(F)ccc2NC1 |
| InChI | InChI=1S/C30H29Cl2F2N7O/c1-17-3-2-4-25(23-11-18(9-10-37-23)20-12-19(33)5-7-22(20)38-14-17)40-16-39-24(13-28(40)42)29-26(41(36)15-27(32)35)8-6-21(31)30(29)34/h5-13,15-17,25,38H,2-4,14,35-36H2,1H3/b27-15- |
| InChIKey | AFYGAPVISFTUGT-DICXZTSXSA-N |
| XLogP | 6.40 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|