C28H29ClFN5O2S — CID 144898628
2-chloro-5-(5-fluoropyrimidin-2-yl)-N-[2-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxypiperidin-1-yl]-2-(4-methyl-1,3-thiazol-5-yl)ethyl]benzamide (PubChem CID 144898628) has the molecular formula C28H29ClFN5O2S and a molecular weight of 554.09 g/mol. Its IUPAC name is 2-chloro-5-(5-fluoropyrimidin-2-yl)-N-[2-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxypiperidin-1-yl]-2-(4-methyl-1,3-thiazol-5-yl)ethyl]benzamide.
| Compound Name | 2-chloro-5-(5-fluoropyrimidin-2-yl)-N-[2-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxypiperidin-1-yl]-2-(4-methyl-1,3-thiazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 144898628 |
| Molecular Formula | C28H29ClFN5O2S |
| Molecular Weight | 554.09 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 2-chloro-5-(5-fluoropyrimidin-2-yl)-N-[2-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxypiperidin-1-yl]-2-(4-methyl-1,3-thiazol-5-yl)ethyl]benzamide |
| SMILES | C=C/C=C\C(=C)OC1CCN(C(CNC(=O)c2cc(-c3ncc(F)cn3)ccc2Cl)c2scnc2C)CC1 |
| InChI | InChI=1S/C28H29ClFN5O2S/c1-4-5-6-18(2)37-22-9-11-35(12-10-22)25(26-19(3)34-17-38-26)16-33-28(36)23-13-20(7-8-24(23)29)27-31-14-21(30)15-32-27/h4-8,13-15,17,22,25H,1-2,9-12,16H2,3H3,(H,33,36)/b6-5- |
| InChIKey | MGYDVXSYTTZBSB-WAYWQWQTSA-N |
| XLogP | 5.91 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.09 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|