C22H25ClFN5O2S — CID 134404912
[4-[[2-chloro-5-(5-fluoropyrimidin-2-yl)benzoyl]amino]-3-morpholin-4-ylbut-1-en-2-yl] N-ethylmethanimidothioate (PubChem CID 134404912) has the molecular formula C22H25ClFN5O2S and a molecular weight of 477.99 g/mol. Its IUPAC name is [4-[[2-chloro-5-(5-fluoropyrimidin-2-yl)benzoyl]amino]-3-morpholin-4-ylbut-1-en-2-yl] N-ethylmethanimidothioate.
| Compound Name | [4-[[2-chloro-5-(5-fluoropyrimidin-2-yl)benzoyl]amino]-3-morpholin-4-ylbut-1-en-2-yl] N-ethylmethanimidothioate |
|---|---|
| PubChem CID | 134404912 |
| Molecular Formula | C22H25ClFN5O2S |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | [4-[[2-chloro-5-(5-fluoropyrimidin-2-yl)benzoyl]amino]-3-morpholin-4-ylbut-1-en-2-yl] N-ethylmethanimidothioate |
| SMILES | C=C(S/C=N/CC)C(CNC(=O)c1cc(-c2ncc(F)cn2)ccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C22H25ClFN5O2S/c1-3-25-14-32-15(2)20(29-6-8-31-9-7-29)13-28-22(30)18-10-16(4-5-19(18)23)21-26-11-17(24)12-27-21/h4-5,10-12,14,20H,2-3,6-9,13H2,1H3,(H,28,30)/b25-14+ |
| InChIKey | YLRJRUVVJREXPG-AFUMVMLFSA-N |
| XLogP | 3.66 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|