C22H24Cl2N4O2 — CID 134925197
(4E)-4-(3,4-dichlorophenyl)-4-(methylidenehydrazinylidene)-N-(4-methylphenyl)-2-morpholin-4-ylbutanamide (PubChem CID 134925197) has the molecular formula C22H24Cl2N4O2 and a molecular weight of 447.37 g/mol. Its IUPAC name is (4E)-4-(3,4-dichlorophenyl)-4-(methylidenehydrazinylidene)-N-(4-methylphenyl)-2-morpholin-4-ylbutanamide.
| Compound Name | (4E)-4-(3,4-dichlorophenyl)-4-(methylidenehydrazinylidene)-N-(4-methylphenyl)-2-morpholin-4-ylbutanamide |
|---|---|
| PubChem CID | 134925197 |
| Molecular Formula | C22H24Cl2N4O2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (4E)-4-(3,4-dichlorophenyl)-4-(methylidenehydrazinylidene)-N-(4-methylphenyl)-2-morpholin-4-ylbutanamide |
| SMILES | C=N/N=C(\CC(C(=O)Nc1ccc(C)cc1)N1CCOCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H24Cl2N4O2/c1-15-3-6-17(7-4-15)26-22(29)21(28-9-11-30-12-10-28)14-20(27-25-2)16-5-8-18(23)19(24)13-16/h3-8,13,21H,2,9-12,14H2,1H3,(H,26,29)/b27-20+ |
| InChIKey | ISMUFTFBFJBAIC-NHFJDJAPSA-N |
| XLogP | 4.44 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|