C21H23Cl2N3O4 — CID 55793069
2-(3,4-dichlorophenoxy)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide (PubChem CID 55793069) has the molecular formula C21H23Cl2N3O4 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide.
| Compound Name | 2-(3,4-dichlorophenoxy)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide |
|---|---|
| PubChem CID | 55793069 |
| Molecular Formula | C21H23Cl2N3O4 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide |
| SMILES | CC(Oc1ccc(Cl)c(Cl)c1)C(=O)Nc1ccc(NC(=O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H23Cl2N3O4/c1-14(30-17-6-7-18(22)19(23)12-17)21(28)25-16-4-2-15(3-5-16)24-20(27)13-26-8-10-29-11-9-26/h2-7,12,14H,8-11,13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | YSFGVJNKUPISRW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |