C41H35N5O — CID 144898728
(Z)-2-(N-amino-3-phenoxazin-10-ylanilino)-1-[4-(9,9-dimethylacridin-10-yl)phenyl]ethenamine (PubChem CID 144898728) has the molecular formula C41H35N5O and a molecular weight of 613.77 g/mol. Its IUPAC name is (Z)-2-(N-amino-3-phenoxazin-10-ylanilino)-1-[4-(9,9-dimethylacridin-10-yl)phenyl]ethenamine.
| Compound Name | (Z)-2-(N-amino-3-phenoxazin-10-ylanilino)-1-[4-(9,9-dimethylacridin-10-yl)phenyl]ethenamine |
|---|---|
| PubChem CID | 144898728 |
| Molecular Formula | C41H35N5O |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | (Z)-2-(N-amino-3-phenoxazin-10-ylanilino)-1-[4-(9,9-dimethylacridin-10-yl)phenyl]ethenamine |
| SMILES | CC1(C)c2ccccc2N(c2ccc(/C(N)=C/N(N)c3cccc(N4c5ccccc5Oc5ccccc54)c3)cc2)c2ccccc21 |
| InChI | InChI=1S/C41H35N5O/c1-41(2)32-14-3-5-16-35(32)45(36-17-6-4-15-33(36)41)29-24-22-28(23-25-29)34(42)27-44(43)30-12-11-13-31(26-30)46-37-18-7-9-20-39(37)47-40-21-10-8-19-38(40)46/h3-27H,42-43H2,1-2H3/b34-27- |
| InChIKey | MBHMHJBNRAMUHT-YLHCSOALSA-N |
| XLogP | 10.01 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|