C25H32O5 — CID 144899354
cyclopropane;3-[3-[[3-(2-methoxyphenoxy)cyclobutyl]methoxy]phenyl]-2-methylpropanoic acid (PubChem CID 144899354) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is cyclopropane;3-[3-[[3-(2-methoxyphenoxy)cyclobutyl]methoxy]phenyl]-2-methylpropanoic acid.
| Compound Name | cyclopropane;3-[3-[[3-(2-methoxyphenoxy)cyclobutyl]methoxy]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 144899354 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | cyclopropane;3-[3-[[3-(2-methoxyphenoxy)cyclobutyl]methoxy]phenyl]-2-methylpropanoic acid |
| SMILES | C1CC1.COc1ccccc1OC1CC(COc2cccc(CC(C)C(=O)O)c2)C1 |
| InChI | InChI=1S/C22H26O5.C3H6/c1-15(22(23)24)10-16-6-5-7-18(11-16)26-14-17-12-19(13-17)27-21-9-4-3-8-20(21)25-2;1-2-3-1/h3-9,11,15,17,19H,10,12-14H2,1-2H3,(H,23,24);1-3H2 |
| InChIKey | LPZIUPXTAKUOSC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |