C24H30O4 — CID 144899368
cyclopropane;2-methyl-3-[3-[(3-phenoxycyclobutyl)methoxy]phenyl]propanoic acid (PubChem CID 144899368) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is cyclopropane;2-methyl-3-[3-[(3-phenoxycyclobutyl)methoxy]phenyl]propanoic acid.
| Compound Name | cyclopropane;2-methyl-3-[3-[(3-phenoxycyclobutyl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 144899368 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | cyclopropane;2-methyl-3-[3-[(3-phenoxycyclobutyl)methoxy]phenyl]propanoic acid |
| SMILES | C1CC1.CC(Cc1cccc(OCC2CC(Oc3ccccc3)C2)c1)C(=O)O |
| InChI | InChI=1S/C21H24O4.C3H6/c1-15(21(22)23)10-16-6-5-9-19(11-16)24-14-17-12-20(13-17)25-18-7-3-2-4-8-18;1-2-3-1/h2-9,11,15,17,20H,10,12-14H2,1H3,(H,22,23);1-3H2 |
| InChIKey | ONBDICUJMCDMMT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |