C22H25ClN2O4 — CID 144899811
(3R)-3-[2-(3-chlorophenyl)ethyl]-1-[hydroxy-[methyl(1-phenylethyl)amino]methyl]-4-oxoazetidine-2-carboxylic acid (PubChem CID 144899811) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is (3R)-3-[2-(3-chlorophenyl)ethyl]-1-[hydroxy-[methyl(1-phenylethyl)amino]methyl]-4-oxoazetidine-2-carboxylic acid.
| Compound Name | (3R)-3-[2-(3-chlorophenyl)ethyl]-1-[hydroxy-[methyl(1-phenylethyl)amino]methyl]-4-oxoazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 144899811 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (3R)-3-[2-(3-chlorophenyl)ethyl]-1-[hydroxy-[methyl(1-phenylethyl)amino]methyl]-4-oxoazetidine-2-carboxylic acid |
| SMILES | CC(c1ccccc1)N(C)C(O)N1C(=O)[C@H](CCc2cccc(Cl)c2)C1C(=O)O |
| InChI | InChI=1S/C22H25ClN2O4/c1-14(16-8-4-3-5-9-16)24(2)22(29)25-19(21(27)28)18(20(25)26)12-11-15-7-6-10-17(23)13-15/h3-10,13-14,18-19,22,29H,11-12H2,1-2H3,(H,27,28)/t14?,18-,19?,22?/m1/s1 |
| InChIKey | WWBSLPZXUBJQIQ-OQFGAVRLSA-N |
| XLogP | 3.15 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|