C23H20ClF2NO6 — CID 149472857
(2R)-1-[2-(3-chlorophenyl)ethyl]-3-[(3S)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)butanoyl]-4-oxoazetidine-2-carboxylic acid (PubChem CID 149472857) has the molecular formula C23H20ClF2NO6 and a molecular weight of 479.86 g/mol. Its IUPAC name is (2R)-1-[2-(3-chlorophenyl)ethyl]-3-[(3S)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)butanoyl]-4-oxoazetidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-(3-chlorophenyl)ethyl]-3-[(3S)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)butanoyl]-4-oxoazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 149472857 |
| Molecular Formula | C23H20ClF2NO6 |
| Molecular Weight | 479.86 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | (2R)-1-[2-(3-chlorophenyl)ethyl]-3-[(3S)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)butanoyl]-4-oxoazetidine-2-carboxylic acid |
| SMILES | C[C@@H](CC(=O)C1C(=O)N(CCc2cccc(Cl)c2)[C@H]1C(=O)O)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C23H20ClF2NO6/c1-12(14-5-6-17-18(11-14)33-23(25,26)32-17)9-16(28)19-20(22(30)31)27(21(19)29)8-7-13-3-2-4-15(24)10-13/h2-6,10-12,19-20H,7-9H2,1H3,(H,30,31)/t12-,19?,20+/m0/s1 |
| InChIKey | ZBRWTEDDEXUCCV-CECXWGIGSA-N |
| XLogP | 3.88 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.86 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|