C18H17N3O2 — CID 144901391
morpholin-4-yl-(4-pyrazolo[1,5-a]pyridin-3-ylphenyl)methanone (PubChem CID 144901391) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is morpholin-4-yl-(4-pyrazolo[1,5-a]pyridin-3-ylphenyl)methanone.
| Compound Name | morpholin-4-yl-(4-pyrazolo[1,5-a]pyridin-3-ylphenyl)methanone |
|---|---|
| PubChem CID | 144901391 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | morpholin-4-yl-(4-pyrazolo[1,5-a]pyridin-3-ylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2cnn3ccccc23)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H17N3O2/c22-18(20-9-11-23-12-10-20)15-6-4-14(5-7-15)16-13-19-21-8-2-1-3-17(16)21/h1-8,13H,9-12H2 |
| InChIKey | JKBWUDMOBPMFCR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |