C23H29F3N4OS — CID 144901556
1,1-dimethylcyclohexane;6-(methylaminosulfanyl)-N-[4-(trifluoromethoxy)phenyl]-1H-benzimidazol-2-amine (PubChem CID 144901556) has the molecular formula C23H29F3N4OS and a molecular weight of 466.57 g/mol. Its IUPAC name is 1,1-dimethylcyclohexane;6-(methylaminosulfanyl)-N-[4-(trifluoromethoxy)phenyl]-1H-benzimidazol-2-amine.
| Compound Name | 1,1-dimethylcyclohexane;6-(methylaminosulfanyl)-N-[4-(trifluoromethoxy)phenyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 144901556 |
| Molecular Formula | C23H29F3N4OS |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 1,1-dimethylcyclohexane;6-(methylaminosulfanyl)-N-[4-(trifluoromethoxy)phenyl]-1H-benzimidazol-2-amine |
| SMILES | CC1(C)CCCCC1.CNSc1ccc2nc(Nc3ccc(OC(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C15H13F3N4OS.C8H16/c1-19-24-11-6-7-12-13(8-11)22-14(21-12)20-9-2-4-10(5-3-9)23-15(16,17)18;1-8(2)6-4-3-5-7-8/h2-8,19H,1H3,(H2,20,21,22);3-7H2,1-2H3 |
| InChIKey | AERWRWXUXLIXBY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|