C13H18 — CID 144902393
2-[(1Z,3Z)-hexa-1,3-dienyl]-6-methylcyclohexa-1,3-diene (PubChem CID 144902393) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 2-[(1Z,3Z)-hexa-1,3-dienyl]-6-methylcyclohexa-1,3-diene.
| Compound Name | 2-[(1Z,3Z)-hexa-1,3-dienyl]-6-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144902393 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-[(1Z,3Z)-hexa-1,3-dienyl]-6-methylcyclohexa-1,3-diene |
| SMILES | CC/C=C\C=C/C1=CC(C)CC=C1 |
| InChI | InChI=1S/C13H18/c1-3-4-5-6-9-13-10-7-8-12(2)11-13/h4-7,9-12H,3,8H2,1-2H3/b5-4-,9-6- |
| InChIKey | LZVBWABXMIPSSY-WXOLFVLTSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|