C14H22 — CID 142209321
6-methyl-2-(4-methylcyclohexyl)cyclohexa-1,3-diene (PubChem CID 142209321) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 6-methyl-2-(4-methylcyclohexyl)cyclohexa-1,3-diene.
| Compound Name | 6-methyl-2-(4-methylcyclohexyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142209321 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 6-methyl-2-(4-methylcyclohexyl)cyclohexa-1,3-diene |
| SMILES | CC1C=C(C2CCC(C)CC2)C=CC1 |
| InChI | InChI=1S/C14H22/c1-11-6-8-13(9-7-11)14-5-3-4-12(2)10-14/h3,5,10-13H,4,6-9H2,1-2H3 |
| InChIKey | NIHCOZZHRSWTDE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |